About [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide
[9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide (PubChem CID 155317178) has the molecular formula C22H28Br2N2O2
and a molecular weight of 512.29 g/mol. Its IUPAC name is [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide.
Molecular Properties
| Compound Name | [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide |
| PubChem CID | 155317178 |
| Molecular Formula | C22H28Br2N2O2 |
| Molecular Weight | 512.29 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide |
| SMILES | C[N+](C)(C)Cc1cc2c(cc1C[N+](C)(C)C)C(=O)c1ccccc1C2=O.[Br-].[Br-] |
| InChI | InChI=1S/C22H28N2O2.2BrH/c1-23(2,3)13-15-11-19-20(12-16(15)14-24(4,5)6)22(26)18-10-8-7-9-17(18)21(19)25;;/h7-12H,13-14H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | YLXFPEQABDGUHL-UHFFFAOYSA-L |
| XLogP | -3.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.29 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide?
The IUPAC name of [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide (CID 155317178) is [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide.
What is the SMILES notation for [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide?
The canonical SMILES for [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide is C[N+](C)(C)Cc1cc2c(cc1C[N+](C)(C)C)C(=O)c1ccccc1C2=O.[Br-].[Br-].
What is the InChIKey of [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide?
The InChIKey is YLXFPEQABDGUHL-UHFFFAOYSA-L. The full InChI is InChI=1S/C22H28N2O2.2BrH/c1-23(2,3)13-15-11-19-20(12-16(15)14-24(4,5)6)22(26)18-10-8-7-9-17(18)21(19)25;;/h7-12H,13-14H2,1-6H3;2*1H/q+2;;/p-2.
What are the key properties of [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide?
[9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide has a molecular weight of 512.29 g/mol, XLogP of -3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [9,10-dioxo-3-[(trimethylazaniumyl)methyl]anthracen-2-yl]methyl-trimethylazanium dibromide is sourced from PubChem (CID 155317178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).