About dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride
dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride (PubChem CID 155317226) has the molecular formula C20H17Cl3N4
and a molecular weight of 419.74 g/mol. Its IUPAC name is dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride.
Molecular Properties
| Compound Name | dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride |
| PubChem CID | 155317226 |
| Molecular Formula | C20H17Cl3N4 |
| Molecular Weight | 419.74 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride |
| SMILES | ClCCl.[Cl-].c1ccc(-c2nn(-c3ccccc3)[n+](-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H15N4.CH2Cl2.ClH/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18;2-1-3;/h1-15H;1H2;1H/q+1;;/p-1 |
| InChIKey | VUHUBCWPXWSXHO-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.74 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride?
The IUPAC name of dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride (CID 155317226) is dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride.
What is the SMILES notation for dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride?
The canonical SMILES for dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride is ClCCl.[Cl-].c1ccc(-c2nn(-c3ccccc3)[n+](-c3ccccc3)n2)cc1.
What is the InChIKey of dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride?
The InChIKey is VUHUBCWPXWSXHO-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H15N4.CH2Cl2.ClH/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18;2-1-3;/h1-15H;1H2;1H/q+1;;/p-1.
What are the key properties of dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride?
dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride has a molecular weight of 419.74 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;2,3,5-triphenyltetrazol-2-ium;chloride is sourced from PubChem (CID 155317226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).