C36H34FN3O9 — CID 155317918
prop-2-enyl (2S,3S,4S,5R)-6-[4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 155317918) has the molecular formula C36H34FN3O9 and a molecular weight of 671.68 g/mol. Its IUPAC name is prop-2-enyl (2S,3S,4S,5R)-6-[4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | prop-2-enyl (2S,3S,4S,5R)-6-[4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 155317918 |
| Molecular Formula | C36H34FN3O9 |
| Molecular Weight | 671.68 g/mol |
| Exact Mass | 671.23 |
| IUPAC Name | prop-2-enyl (2S,3S,4S,5R)-6-[4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1OC(OC(=O)c2ccc(-c3c(C4CCOCC4)n(-c4ccc(F)cc4)c4cc5cn[nH]c5cc34)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C36H34FN3O9/c1-2-13-47-35(45)33-31(42)30(41)32(43)36(48-33)49-34(44)21-5-3-19(4-6-21)28-25-17-26-22(18-38-39-26)16-27(25)40(24-9-7-23(37)8-10-24)29(28)20-11-14-46-15-12-20/h2-10,16-18,20,30-33,36,41-43H,1,11-15H2,(H,38,39)/t30-,31-,32+,33-,36?/m0/s1 |
| InChIKey | UGFMWKMSFQYUNY-IJOPIYGZSA-N |
| XLogP | 3.90 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|