About 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate
2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate (PubChem CID 155318100) has the molecular formula C19H16F2N2O3
and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate |
| PubChem CID | 155318100 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate |
| SMILES | C#CC(C)(C)OC(=O)c1cc(NC(=O)Cc2cc(F)ccc2F)ccn1 |
| InChI | InChI=1S/C19H16F2N2O3/c1-4-19(2,3)26-18(25)16-11-14(7-8-22-16)23-17(24)10-12-9-13(20)5-6-15(12)21/h1,5-9,11H,10H2,2-3H3,(H,22,23,24) |
| InChIKey | SDTAXIVBRWGCPL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate?
The IUPAC name of 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate (CID 155318100) is 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate.
What is the SMILES notation for 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate?
The canonical SMILES for 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate is C#CC(C)(C)OC(=O)c1cc(NC(=O)Cc2cc(F)ccc2F)ccn1.
What is the InChIKey of 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate?
The InChIKey is SDTAXIVBRWGCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N2O3/c1-4-19(2,3)26-18(25)16-11-14(7-8-22-16)23-17(24)10-12-9-13(20)5-6-15(12)21/h1,5-9,11H,10H2,2-3H3,(H,22,23,24).
What are the key properties of 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate?
2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate has a molecular weight of 358.34 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-yn-2-yl 4-[[2-(2,5-difluorophenyl)acetyl]amino]pyridine-2-carboxylate is sourced from PubChem (CID 155318100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).