C27H43F8N2O6P — CID 155318364
[2-[5-[1,3-difluoro-3-(hydroxymethyl)-2-methylphosphiran-2-yl]oxy-3,3,4,4-tetrafluoro-2-methylpentan-2-yl]oxy-2,2-difluoroethyl] N-[1,3,3-trimethyl-5-[(2-methylpropanoylamino)methyl]cyclohexyl]carbamate (PubChem CID 155318364) has the molecular formula C27H43F8N2O6P and a molecular weight of 674.61 g/mol. Its IUPAC name is [2-[5-[1,3-difluoro-3-(hydroxymethyl)-2-methylphosphiran-2-yl]oxy-3,3,4,4-tetrafluoro-2-methylpentan-2-yl]oxy-2,2-difluoroethyl] N-[1,3,3-trimethyl-5-[(2-methylpropanoylamino)methyl]cyclohexyl]carbamate.
| Compound Name | [2-[5-[1,3-difluoro-3-(hydroxymethyl)-2-methylphosphiran-2-yl]oxy-3,3,4,4-tetrafluoro-2-methylpentan-2-yl]oxy-2,2-difluoroethyl] N-[1,3,3-trimethyl-5-[(2-methylpropanoylamino)methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 155318364 |
| Molecular Formula | C27H43F8N2O6P |
| Molecular Weight | 674.61 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | [2-[5-[1,3-difluoro-3-(hydroxymethyl)-2-methylphosphiran-2-yl]oxy-3,3,4,4-tetrafluoro-2-methylpentan-2-yl]oxy-2,2-difluoroethyl] N-[1,3,3-trimethyl-5-[(2-methylpropanoylamino)methyl]cyclohexyl]carbamate |
| SMILES | CC(C)C(=O)NCC1CC(C)(C)CC(C)(NC(=O)OCC(F)(F)OC(C)(C)C(F)(F)C(F)(F)COC2(C)P(F)C2(F)CO)C1 |
| InChI | InChI=1S/C27H43F8N2O6P/c1-16(2)18(39)36-11-17-9-20(3,4)12-22(7,10-17)37-19(40)41-15-26(31,32)43-21(5,6)27(33,34)24(28,29)14-42-23(8)25(30,13-38)44(23)35/h16-17,38H,9-15H2,1-8H3,(H,36,39)(H,37,40) |
| InChIKey | OTMLGPLPIZOUKU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|