C33H33FN4O4 — CID 155318434
ethyl 4-[4-(2,2-dimethylpropanoyl)-10-(4-fluorophenyl)-11-(oxan-4-yl)-2,4,5,10-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaen-12-yl]benzoate (PubChem CID 155318434) has the molecular formula C33H33FN4O4 and a molecular weight of 568.65 g/mol. Its IUPAC name is ethyl 4-[4-(2,2-dimethylpropanoyl)-10-(4-fluorophenyl)-11-(oxan-4-yl)-2,4,5,10-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaen-12-yl]benzoate.
| Compound Name | ethyl 4-[4-(2,2-dimethylpropanoyl)-10-(4-fluorophenyl)-11-(oxan-4-yl)-2,4,5,10-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaen-12-yl]benzoate |
|---|---|
| PubChem CID | 155318434 |
| Molecular Formula | C33H33FN4O4 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | ethyl 4-[4-(2,2-dimethylpropanoyl)-10-(4-fluorophenyl)-11-(oxan-4-yl)-2,4,5,10-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaen-12-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cc4cnn(C(=O)C(C)(C)C)c4nc23)cc1 |
| InChI | InChI=1S/C33H33FN4O4/c1-5-42-31(39)22-8-6-20(7-9-22)27-28-26(18-23-19-35-38(30(23)36-28)32(40)33(2,3)4)37(25-12-10-24(34)11-13-25)29(27)21-14-16-41-17-15-21/h6-13,18-19,21H,5,14-17H2,1-4H3 |
| InChIKey | XNVZBZYCRMTYGO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |