C16H20O3 — CID 155318975
2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3,5-triol (PubChem CID 155318975) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3,5-triol.
| Compound Name | 2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 155318975 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3,5-triol |
| SMILES | C=C(C)[C@H]1CCC(C)=C[C@@H]1c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C16H20O3/c1-9(2)12-5-4-10(3)6-13(12)16-14(18)7-11(17)8-15(16)19/h6-8,12-13,17-19H,1,4-5H2,2-3H3/t12-,13+/m1/s1 |
| InChIKey | ZSBGNUPOFUYDMQ-OLZOCXBDSA-N |
| XLogP | 3.82 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|