C24H27F2N5O4 — CID 155319429
3-[1-[4-[[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]amino]-2,6-difluorophenyl]pyrrolidin-3-yl]-1,1-dimethylurea (PubChem CID 155319429) has the molecular formula C24H27F2N5O4 and a molecular weight of 487.51 g/mol. Its IUPAC name is 3-[1-[4-[[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]amino]-2,6-difluorophenyl]pyrrolidin-3-yl]-1,1-dimethylurea.
| Compound Name | 3-[1-[4-[[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]amino]-2,6-difluorophenyl]pyrrolidin-3-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 155319429 |
| Molecular Formula | C24H27F2N5O4 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 3-[1-[4-[[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]amino]-2,6-difluorophenyl]pyrrolidin-3-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1CCN(c2c(F)cc(NCC(O)CN3C(=O)c4ccccc4C3=O)cc2F)C1 |
| InChI | InChI=1S/C24H27F2N5O4/c1-29(2)24(35)28-14-7-8-30(12-14)21-19(25)9-15(10-20(21)26)27-11-16(32)13-31-22(33)17-5-3-4-6-18(17)23(31)34/h3-6,9-10,14,16,27,32H,7-8,11-13H2,1-2H3,(H,28,35) |
| InChIKey | ALSILZDJCCOOKK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|