C25H29F2N3O5S — CID 155319454
2-[(2R)-3-[4-(6,6-dihydroxy-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluoroanilino]-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 155319454) has the molecular formula C25H29F2N3O5S and a molecular weight of 521.59 g/mol. Its IUPAC name is 2-[(2R)-3-[4-(6,6-dihydroxy-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluoroanilino]-2-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-3-[4-(6,6-dihydroxy-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluoroanilino]-2-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155319454 |
| Molecular Formula | C25H29F2N3O5S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 2-[(2R)-3-[4-(6,6-dihydroxy-1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluoroanilino]-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H](O)CNc1cc(F)c(N2CC3CCS(O)(O)CCC3C2)c(F)c1 |
| InChI | InChI=1S/C25H29F2N3O5S/c26-21-9-17(28-11-18(31)14-30-24(32)19-3-1-2-4-20(19)25(30)33)10-22(27)23(21)29-12-15-5-7-36(34,35)8-6-16(15)13-29/h1-4,9-10,15-16,18,28,31,34-35H,5-8,11-14H2/t15?,16?,18-/m1/s1 |
| InChIKey | JTENWKFMGBPCIF-LEOMRAHMSA-N |
| XLogP | 3.63 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|