C34H38F6N8O2 — CID 155319514
3-methyl-2-[6-[(1-methylpyrrolidin-3-yl)amino]pyridazin-3-yl]-5-(trifluoromethyl)phenol (PubChem CID 155319514) has the molecular formula C34H38F6N8O2 and a molecular weight of 704.72 g/mol. Its IUPAC name is 3-methyl-2-[6-[(1-methylpyrrolidin-3-yl)amino]pyridazin-3-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 3-methyl-2-[6-[(1-methylpyrrolidin-3-yl)amino]pyridazin-3-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 155319514 |
| Molecular Formula | C34H38F6N8O2 |
| Molecular Weight | 704.72 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | 3-methyl-2-[6-[(1-methylpyrrolidin-3-yl)amino]pyridazin-3-yl]-5-(trifluoromethyl)phenol |
| SMILES | Cc1cc(C(F)(F)F)cc(O)c1-c1ccc(NC2CCN(C)C2)nn1.Cc1cc(C(F)(F)F)cc(O)c1-c1ccc(NC2CCN(C)C2)nn1 |
| InChI | InChI=1S/2C17H19F3N4O/c2*1-10-7-11(17(18,19)20)8-14(25)16(10)13-3-4-15(23-22-13)21-12-5-6-24(2)9-12/h2*3-4,7-8,12,25H,5-6,9H2,1-2H3,(H,21,23) |
| InChIKey | UHQIUIVJIPITAT-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.72 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |