C14H12F5N3O2 — CID 155319851
5-fluoro-3-[(2-methoxy-6-methyl-3-pyridinyl)methyl]-6-(1,1,2,2-tetrafluoroethyl)pyrimidin-4-one (PubChem CID 155319851) has the molecular formula C14H12F5N3O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is 5-fluoro-3-[(2-methoxy-6-methyl-3-pyridinyl)methyl]-6-(1,1,2,2-tetrafluoroethyl)pyrimidin-4-one.
| Compound Name | 5-fluoro-3-[(2-methoxy-6-methyl-3-pyridinyl)methyl]-6-(1,1,2,2-tetrafluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 155319851 |
| Molecular Formula | C14H12F5N3O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 5-fluoro-3-[(2-methoxy-6-methyl-3-pyridinyl)methyl]-6-(1,1,2,2-tetrafluoroethyl)pyrimidin-4-one |
| SMILES | COc1nc(C)ccc1Cn1cnc(C(F)(F)C(F)F)c(F)c1=O |
| InChI | InChI=1S/C14H12F5N3O2/c1-7-3-4-8(11(21-7)24-2)5-22-6-20-10(9(15)12(22)23)14(18,19)13(16)17/h3-4,6,13H,5H2,1-2H3 |
| InChIKey | UBMVPYRPIMHDHP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|