About [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid
[3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid (PubChem CID 155319958) has the molecular formula C13H14N2O5
and a molecular weight of 278.26 g/mol. Its IUPAC name is [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid.
Molecular Properties
| Compound Name | [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid |
| PubChem CID | 155319958 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid |
| SMILES | O=C(O)NCCC(=O)c1ccc(N2CCOC2=O)cc1 |
| InChI | InChI=1S/C13H14N2O5/c16-11(5-6-14-12(17)18)9-1-3-10(4-2-9)15-7-8-20-13(15)19/h1-4,14H,5-8H2,(H,17,18) |
| InChIKey | WOPPNXBPQPDZLR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid?
The IUPAC name of [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid (CID 155319958) is [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid.
What is the SMILES notation for [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid?
The canonical SMILES for [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid is O=C(O)NCCC(=O)c1ccc(N2CCOC2=O)cc1.
What is the InChIKey of [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid?
The InChIKey is WOPPNXBPQPDZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O5/c16-11(5-6-14-12(17)18)9-1-3-10(4-2-9)15-7-8-20-13(15)19/h1-4,14H,5-8H2,(H,17,18).
What are the key properties of [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid?
[3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid has a molecular weight of 278.26 g/mol, XLogP of 1.48, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propyl]carbamic acid is sourced from PubChem (CID 155319958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).