C9H11N5O2 — CID 15532008
6-(3,4-diaminophenyl)-1,3,5-triazinane-2,4-dione (PubChem CID 15532008) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 6-(3,4-diaminophenyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-(3,4-diaminophenyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 15532008 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 6-(3,4-diaminophenyl)-1,3,5-triazinane-2,4-dione |
| SMILES | Nc1ccc(C2NC(=O)NC(=O)N2)cc1N |
| InChI | InChI=1S/C9H11N5O2/c10-5-2-1-4(3-6(5)11)7-12-8(15)14-9(16)13-7/h1-3,7H,10-11H2,(H3,12,13,14,15,16) |
| InChIKey | BOBUMZNSLQGJDW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|