C16H31N5O9S — CID 155320479
tert-butyl 3-[2-[2-[2-(2-azidoethoxycarbonylsulfamoylamino)ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 155320479) has the molecular formula C16H31N5O9S and a molecular weight of 469.52 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-(2-azidoethoxycarbonylsulfamoylamino)ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-(2-azidoethoxycarbonylsulfamoylamino)ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 155320479 |
| Molecular Formula | C16H31N5O9S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-(2-azidoethoxycarbonylsulfamoylamino)ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCNS(=O)(=O)NC(=O)OCCN=[N+]=[N-] |
| InChI | InChI=1S/C16H31N5O9S/c1-16(2,3)30-14(22)4-7-26-10-12-28-13-11-27-8-6-19-31(24,25)20-15(23)29-9-5-18-21-17/h19H,4-13H2,1-3H3,(H,20,23) |
| InChIKey | KWNKUBHSOVCILB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|