C15H18N2O2S — CID 155320998
butyl 5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxylate (PubChem CID 155320998) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is butyl 5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxylate.
| Compound Name | butyl 5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 155320998 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | butyl 5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxylate |
| SMILES | CCCCOC(=O)c1nc2cc3c(nc2s1)CCCC3 |
| InChI | InChI=1S/C15H18N2O2S/c1-2-3-8-19-15(18)14-17-12-9-10-6-4-5-7-11(10)16-13(12)20-14/h9H,2-8H2,1H3 |
| InChIKey | BSYXZEDANLOYTF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|