C17H18N2OS — CID 155321685
(7S)-2-sulfanylidenespiro[1,5,6,8-tetrahydroquinazoline-7,3'-2,4-dihydro-1H-naphthalene]-4-one (PubChem CID 155321685) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is (7S)-2-sulfanylidenespiro[1,5,6,8-tetrahydroquinazoline-7,3'-2,4-dihydro-1H-naphthalene]-4-one.
| Compound Name | (7S)-2-sulfanylidenespiro[1,5,6,8-tetrahydroquinazoline-7,3'-2,4-dihydro-1H-naphthalene]-4-one |
|---|---|
| PubChem CID | 155321685 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (7S)-2-sulfanylidenespiro[1,5,6,8-tetrahydroquinazoline-7,3'-2,4-dihydro-1H-naphthalene]-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CC[C@]1(CCc3ccccc3C1)C2 |
| InChI | InChI=1S/C17H18N2OS/c20-15-13-6-8-17(10-14(13)18-16(21)19-15)7-5-11-3-1-2-4-12(11)9-17/h1-4H,5-10H2,(H2,18,19,20,21)/t17-/m0/s1 |
| InChIKey | FMYKEVZYXPCMDJ-KRWDZBQOSA-N |
| XLogP | 3.10 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|