C17H20O3 — CID 155321803
4-[(2S)-1-oxo-2-prop-2-enyl-3,4-dihydronaphthalen-2-yl]butanoic acid (PubChem CID 155321803) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 4-[(2S)-1-oxo-2-prop-2-enyl-3,4-dihydronaphthalen-2-yl]butanoic acid.
| Compound Name | 4-[(2S)-1-oxo-2-prop-2-enyl-3,4-dihydronaphthalen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 155321803 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-[(2S)-1-oxo-2-prop-2-enyl-3,4-dihydronaphthalen-2-yl]butanoic acid |
| SMILES | C=CC[C@]1(CCCC(=O)O)CCc2ccccc2C1=O |
| InChI | InChI=1S/C17H20O3/c1-2-10-17(11-5-8-15(18)19)12-9-13-6-3-4-7-14(13)16(17)20/h2-4,6-7H,1,5,8-12H2,(H,18,19)/t17-/m0/s1 |
| InChIKey | XHXLWHDMIQACOV-KRWDZBQOSA-N |
| XLogP | 3.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|