About 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol
3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol (PubChem CID 15532232) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol.
Molecular Properties
| Compound Name | 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol |
| PubChem CID | 15532232 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol |
| SMILES | C=C/C=C(\C)COc1ccc(O)cc1C |
| InChI | InChI=1S/C13H16O2/c1-4-5-10(2)9-15-13-7-6-12(14)8-11(13)3/h4-8,14H,1,9H2,2-3H3/b10-5+ |
| InChIKey | NREGEPIKFGNRJP-BJMVGYQFSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol?
The IUPAC name of 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol (CID 15532232) is 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol.
What is the SMILES notation for 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol?
The canonical SMILES for 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol is C=C/C=C(\C)COc1ccc(O)cc1C.
What is the InChIKey of 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol?
The InChIKey is NREGEPIKFGNRJP-BJMVGYQFSA-N. The full InChI is InChI=1S/C13H16O2/c1-4-5-10(2)9-15-13-7-6-12(14)8-11(13)3/h4-8,14H,1,9H2,2-3H3/b10-5+.
What are the key properties of 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol?
3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol has a molecular weight of 204.27 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[(2E)-2-methylpenta-2,4-dienoxy]phenol is sourced from PubChem (CID 15532232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).