C12H14O3 — CID 15532244
(1R,4R,8R,12S)-1-methoxy-2-oxatricyclo[6.3.1.04,12]dodeca-5,10-dien-9-one (PubChem CID 15532244) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1R,4R,8R,12S)-1-methoxy-2-oxatricyclo[6.3.1.04,12]dodeca-5,10-dien-9-one.
| Compound Name | (1R,4R,8R,12S)-1-methoxy-2-oxatricyclo[6.3.1.04,12]dodeca-5,10-dien-9-one |
|---|---|
| PubChem CID | 15532244 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1R,4R,8R,12S)-1-methoxy-2-oxatricyclo[6.3.1.04,12]dodeca-5,10-dien-9-one |
| SMILES | CO[C@]12C=CC(=O)[C@@H]3CC=C[C@@H](CO1)[C@@H]32 |
| InChI | InChI=1S/C12H14O3/c1-14-12-6-5-10(13)9-4-2-3-8(7-15-12)11(9)12/h2-3,5-6,8-9,11H,4,7H2,1H3/t8-,9-,11-,12+/m0/s1 |
| InChIKey | OTVGIFKLZPNFKB-FSZOTQKASA-N |
| XLogP | 1.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|