C14H27NO2 — CID 155322720
N-tert-butyl-2,2,5,5-tetramethyl-3-oxohexanamide (PubChem CID 155322720) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is N-tert-butyl-2,2,5,5-tetramethyl-3-oxohexanamide.
| Compound Name | N-tert-butyl-2,2,5,5-tetramethyl-3-oxohexanamide |
|---|---|
| PubChem CID | 155322720 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-tert-butyl-2,2,5,5-tetramethyl-3-oxohexanamide |
| SMILES | CC(C)(C)CC(=O)C(C)(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H27NO2/c1-12(2,3)9-10(16)14(7,8)11(17)15-13(4,5)6/h9H2,1-8H3,(H,15,17) |
| InChIKey | SWFKQXQDFQUUKD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|