C22H21F2N3O4S — CID 155323149
6-[2-(4,6-difluorocyclohexa-2,4-dien-1-yl)oxy-5-(ethylsulfonylmethyl)phenyl]-8-methyl-2H-pyrrolo[1,2-d][1,2,4]triazin-1-one (PubChem CID 155323149) has the molecular formula C22H21F2N3O4S and a molecular weight of 461.49 g/mol. Its IUPAC name is 6-[2-(4,6-difluorocyclohexa-2,4-dien-1-yl)oxy-5-(ethylsulfonylmethyl)phenyl]-8-methyl-2H-pyrrolo[1,2-d][1,2,4]triazin-1-one.
| Compound Name | 6-[2-(4,6-difluorocyclohexa-2,4-dien-1-yl)oxy-5-(ethylsulfonylmethyl)phenyl]-8-methyl-2H-pyrrolo[1,2-d][1,2,4]triazin-1-one |
|---|---|
| PubChem CID | 155323149 |
| Molecular Formula | C22H21F2N3O4S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 6-[2-(4,6-difluorocyclohexa-2,4-dien-1-yl)oxy-5-(ethylsulfonylmethyl)phenyl]-8-methyl-2H-pyrrolo[1,2-d][1,2,4]triazin-1-one |
| SMILES | CCS(=O)(=O)Cc1ccc(OC2C=CC(F)=CC2F)c(-c2cc(C)c3c(=O)[nH]ncn23)c1 |
| InChI | InChI=1S/C22H21F2N3O4S/c1-3-32(29,30)11-14-4-6-19(31-20-7-5-15(23)10-17(20)24)16(9-14)18-8-13(2)21-22(28)26-25-12-27(18)21/h4-10,12,17,20H,3,11H2,1-2H3,(H,26,28) |
| InChIKey | UWHPBGKVLYVCHJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |