About (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine
(E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine (PubChem CID 155323205) has the molecular formula C6H8F5N
and a molecular weight of 189.13 g/mol. Its IUPAC name is (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine.
Analyze (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine?
The IUPAC name of (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine (CID 155323205) is (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine.
What is the SMILES notation for (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine?
The canonical SMILES for (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine is CN(C)/C(=C(/F)CF)C(F)(F)F.
What is the InChIKey of (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine?
The InChIKey is UEAKQTGLTYQEPU-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H8F5N/c1-12(2)5(4(8)3-7)6(9,10)11/h3H2,1-2H3/b5-4+.
What are the key properties of (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine?
(E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine has a molecular weight of 189.13 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1,1,3,4-pentafluoro-N,N-dimethylbut-2-en-2-amine is sourced from PubChem (CID 155323205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).