C19H24ClIN6O2S — CID 155323383
[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-3-[(3S,4S)-4-amino-3-iodo-2-oxa-8-azaspiro[4.5]decan-8-yl]-5-methylpyrazin-2-yl]methanol (PubChem CID 155323383) has the molecular formula C19H24ClIN6O2S and a molecular weight of 562.87 g/mol. Its IUPAC name is [6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-3-[(3S,4S)-4-amino-3-iodo-2-oxa-8-azaspiro[4.5]decan-8-yl]-5-methylpyrazin-2-yl]methanol.
| Compound Name | [6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-3-[(3S,4S)-4-amino-3-iodo-2-oxa-8-azaspiro[4.5]decan-8-yl]-5-methylpyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 155323383 |
| Molecular Formula | C19H24ClIN6O2S |
| Molecular Weight | 562.87 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | [6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-3-[(3S,4S)-4-amino-3-iodo-2-oxa-8-azaspiro[4.5]decan-8-yl]-5-methylpyrazin-2-yl]methanol |
| SMILES | Cc1nc(N2CCC3(CC2)CO[C@@H](I)[C@H]3N)c(CO)nc1Sc1ccnc(N)c1Cl |
| InChI | InChI=1S/C19H24ClIN6O2S/c1-10-18(30-12-2-5-24-16(23)13(12)20)26-11(8-28)17(25-10)27-6-3-19(4-7-27)9-29-15(21)14(19)22/h2,5,14-15,28H,3-4,6-9,22H2,1H3,(H2,23,24)/t14-,15-/m1/s1 |
| InChIKey | OJXHTGKGVPICRM-HUUCEWRRSA-N |
| XLogP | 2.76 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|