C13H10F6O8S — CID 155323453
3,3,3-trifluoro-2-(trifluoromethyl)-2-[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]oxypropane-1-sulfonic acid (PubChem CID 155323453) has the molecular formula C13H10F6O8S and a molecular weight of 440.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(trifluoromethyl)-2-[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-(trifluoromethyl)-2-[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 155323453 |
| Molecular Formula | C13H10F6O8S |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 3,3,3-trifluoro-2-(trifluoromethyl)-2-[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(/C=C/c1cc(O)c(O)c(O)c1)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H10F6O8S/c14-12(15,16)11(13(17,18)19,5-28(24,25)26)27-9(22)2-1-6-3-7(20)10(23)8(21)4-6/h1-4,20-21,23H,5H2,(H,24,25,26)/b2-1+ |
| InChIKey | UTCAAIYDCIQUJQ-OWOJBTEDSA-N |
| XLogP | 2.11 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|