C14H18F3IO4 — CID 155323518
[2-oxo-5-(3,3,3-trifluoropropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-iodobutanoate (PubChem CID 155323518) has the molecular formula C14H18F3IO4 and a molecular weight of 434.19 g/mol. Its IUPAC name is [2-oxo-5-(3,3,3-trifluoropropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-iodobutanoate.
| Compound Name | [2-oxo-5-(3,3,3-trifluoropropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-iodobutanoate |
|---|---|
| PubChem CID | 155323518 |
| Molecular Formula | C14H18F3IO4 |
| Molecular Weight | 434.19 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | [2-oxo-5-(3,3,3-trifluoropropyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl] 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC1C(CCC(F)(F)F)CC2CC(=O)OC21 |
| InChI | InChI=1S/C14H18F3IO4/c1-2-9(18)13(20)22-11-7(3-4-14(15,16)17)5-8-6-10(19)21-12(8)11/h7-9,11-12H,2-6H2,1H3 |
| InChIKey | IAAFXWSRICCFPN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|