C15H27N — CID 155323692
(E,2S,4S)-2-ethyl-4-methyl-6-prop-2-enylnon-7-en-1-imine (PubChem CID 155323692) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (E,2S,4S)-2-ethyl-4-methyl-6-prop-2-enylnon-7-en-1-imine.
| Compound Name | (E,2S,4S)-2-ethyl-4-methyl-6-prop-2-enylnon-7-en-1-imine |
|---|---|
| PubChem CID | 155323692 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (E,2S,4S)-2-ethyl-4-methyl-6-prop-2-enylnon-7-en-1-imine |
| SMILES | [H]/N=C/[C@@H](CC)C[C@@H](C)CC(/C=C/C)CC=C |
| InChI | InChI=1S/C15H27N/c1-5-8-15(9-6-2)11-13(4)10-14(7-3)12-16/h5-6,9,12-16H,1,7-8,10-11H2,2-4H3/b9-6+,16-12+/t13-,14+,15?/m1/s1 |
| InChIKey | XNINDLJUDSGMPO-COZIEBMHSA-N |
| XLogP | 4.85 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|