About 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol
3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol (PubChem CID 155323766) has the molecular formula C9H13F2NO
and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol |
| PubChem CID | 155323766 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol |
| SMILES | NC(CCO)C1=C(F)C=CC(F)C1 |
| InChI | InChI=1S/C9H13F2NO/c10-6-1-2-8(11)7(5-6)9(12)3-4-13/h1-2,6,9,13H,3-5,12H2 |
| InChIKey | ABPNWKFUHFSYLA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol?
The IUPAC name of 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol (CID 155323766) is 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol.
What is the SMILES notation for 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol?
The canonical SMILES for 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol is NC(CCO)C1=C(F)C=CC(F)C1.
What is the InChIKey of 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol?
The InChIKey is ABPNWKFUHFSYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO/c10-6-1-2-8(11)7(5-6)9(12)3-4-13/h1-2,6,9,13H,3-5,12H2.
What are the key properties of 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol?
3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol has a molecular weight of 189.21 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(2,5-difluorocyclohexa-1,3-dien-1-yl)propan-1-ol is sourced from PubChem (CID 155323766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).