About (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine
(3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine (PubChem CID 155324078) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine |
| PubChem CID | 155324078 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine |
| SMILES | C=NNC(=C)/C=C(/C)CCC(C)C |
| InChI | InChI=1S/C11H20N2/c1-9(2)6-7-10(3)8-11(4)13-12-5/h8-9,13H,4-7H2,1-3H3/b10-8- |
| InChIKey | GEIXOFFDEMHJLL-NTMALXAHSA-N |
| XLogP | 3.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine?
The IUPAC name of (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine (CID 155324078) is (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine.
What is the SMILES notation for (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine?
The canonical SMILES for (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine is C=NNC(=C)/C=C(/C)CCC(C)C.
What is the InChIKey of (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine?
The InChIKey is GEIXOFFDEMHJLL-NTMALXAHSA-N. The full InChI is InChI=1S/C11H20N2/c1-9(2)6-7-10(3)8-11(4)13-12-5/h8-9,13H,4-7H2,1-3H3/b10-8-.
What are the key properties of (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine?
(3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine has a molecular weight of 180.29 g/mol, XLogP of 3.09, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4,7-dimethyl-N-(methylideneamino)octa-1,3-dien-2-amine is sourced from PubChem (CID 155324078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).