About 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone
1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone (PubChem CID 155324142) has the molecular formula C11H11FO4
and a molecular weight of 226.20 g/mol. Its IUPAC name is 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone |
| PubChem CID | 155324142 |
| Molecular Formula | C11H11FO4 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone |
| SMILES | CC(=O)c1cc(F)cc2c1OC[C@H](CO)O2 |
| InChI | InChI=1S/C11H11FO4/c1-6(14)9-2-7(12)3-10-11(9)15-5-8(4-13)16-10/h2-3,8,13H,4-5H2,1H3/t8-/m0/s1 |
| InChIKey | FMGFTSBALPEDHE-QMMMGPOBSA-N |
| XLogP | 1.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone?
The IUPAC name of 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone (CID 155324142) is 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone.
What is the SMILES notation for 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone?
The canonical SMILES for 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone is CC(=O)c1cc(F)cc2c1OC[C@H](CO)O2.
What is the InChIKey of 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone?
The InChIKey is FMGFTSBALPEDHE-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H11FO4/c1-6(14)9-2-7(12)3-10-11(9)15-5-8(4-13)16-10/h2-3,8,13H,4-5H2,1H3/t8-/m0/s1.
What are the key properties of 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone?
1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone has a molecular weight of 226.20 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-7-fluoro-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone is sourced from PubChem (CID 155324142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).