C13H12F3NO — CID 155324545
(2E,4Z)-6-[5-(trifluoromethyl)-2-pyridinyl]hepta-2,4,6-trien-3-ol (PubChem CID 155324545) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is (2E,4Z)-6-[5-(trifluoromethyl)-2-pyridinyl]hepta-2,4,6-trien-3-ol.
| Compound Name | (2E,4Z)-6-[5-(trifluoromethyl)-2-pyridinyl]hepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 155324545 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2E,4Z)-6-[5-(trifluoromethyl)-2-pyridinyl]hepta-2,4,6-trien-3-ol |
| SMILES | C=C(/C=C\C(O)=C/C)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H12F3NO/c1-3-11(18)6-4-9(2)12-7-5-10(8-17-12)13(14,15)16/h3-8,18H,2H2,1H3/b6-4-,11-3+ |
| InChIKey | YEOXCHIWWHYZNZ-TYTBFOFYSA-N |
| XLogP | 4.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|