About 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate
2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate (PubChem CID 155325267) has the molecular formula C21H25ClN2O2
and a molecular weight of 372.90 g/mol. Its IUPAC name is 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate |
| PubChem CID | 155325267 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(C(=O)OCCc2ccc(C)cc2)cc1C |
| InChI | InChI=1S/C21H25ClN2O2/c1-5-24(4)14-23-20-13-19(22)18(12-16(20)3)21(25)26-11-10-17-8-6-15(2)7-9-17/h6-9,12-14H,5,10-11H2,1-4H3/b23-14+ |
| InChIKey | HIZKVZWVUCGEAM-OEAKJJBVSA-N |
| XLogP | 4.97 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate?
The IUPAC name of 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate (CID 155325267) is 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate.
What is the SMILES notation for 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate?
The canonical SMILES for 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate is CCN(C)/C=N/c1cc(Cl)c(C(=O)OCCc2ccc(C)cc2)cc1C.
What is the InChIKey of 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate?
The InChIKey is HIZKVZWVUCGEAM-OEAKJJBVSA-N. The full InChI is InChI=1S/C21H25ClN2O2/c1-5-24(4)14-23-20-13-19(22)18(12-16(20)3)21(25)26-11-10-17-8-6-15(2)7-9-17/h6-9,12-14H,5,10-11H2,1-4H3/b23-14+.
What are the key properties of 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate?
2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate has a molecular weight of 372.90 g/mol, XLogP of 4.97, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)ethyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate is sourced from PubChem (CID 155325267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).