C9H11F3INO — CID 155325541
1-[(2S,4S)-4-iodo-2-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 155325541) has the molecular formula C9H11F3INO and a molecular weight of 333.09 g/mol. Its IUPAC name is 1-[(2S,4S)-4-iodo-2-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,4S)-4-iodo-2-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155325541 |
| Molecular Formula | C9H11F3INO |
| Molecular Weight | 333.09 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 1-[(2S,4S)-4-iodo-2-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](I)C[C@@H]1CC(F)(F)F |
| InChI | InChI=1S/C9H11F3INO/c1-2-8(15)14-5-6(13)3-7(14)4-9(10,11)12/h2,6-7H,1,3-5H2/t6-,7+/m0/s1 |
| InChIKey | JFHBJNSEWFKGQB-NKWVEPMBSA-N |
| XLogP | 2.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.09 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|