C25H32FN7O5 — CID 155326098
(2S,11S)-11-[[(2S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylbutanoyl]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide (PubChem CID 155326098) has the molecular formula C25H32FN7O5 and a molecular weight of 529.57 g/mol. Its IUPAC name is (2S,11S)-11-[[(2S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylbutanoyl]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide.
| Compound Name | (2S,11S)-11-[[(2S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylbutanoyl]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
|---|---|
| PubChem CID | 155326098 |
| Molecular Formula | C25H32FN7O5 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (2S,11S)-11-[[(2S)-2-[[2-(2-fluoroethoxy)acetyl]amino]-3-methylbutanoyl]amino]-12-oxo-N-(2H-triazol-4-ylmethyl)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)COCCF)C(=O)N[C@H]1CCc2cccc3c2N(C1=O)[C@H](C(=O)NCc1cn[nH]n1)C3 |
| InChI | InChI=1S/C25H32FN7O5/c1-14(2)21(30-20(34)13-38-9-8-26)24(36)29-18-7-6-15-4-3-5-16-10-19(33(22(15)16)25(18)37)23(35)27-11-17-12-28-32-31-17/h3-5,12,14,18-19,21H,6-11,13H2,1-2H3,(H,27,35)(H,29,36)(H,30,34)(H,28,31,32)/t18-,19-,21-/m0/s1 |
| InChIKey | RYHBCBZYXJMLGX-ZJOUEHCJSA-N |
| XLogP | -0.06 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|