C30H38N2 — CID 155326434
(3S,8R,9S,10R,13S,14S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-amine (PubChem CID 155326434) has the molecular formula C30H38N2 and a molecular weight of 426.65 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-amine.
| Compound Name | (3S,8R,9S,10R,13S,14S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 155326434 |
| Molecular Formula | C30H38N2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-amine |
| SMILES | CN(C)[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4ccc5ccncc5c4)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H38N2/c1-29-14-11-24(32(3)4)18-23(29)7-8-25-27-10-9-26(30(27,2)15-12-28(25)29)21-6-5-20-13-16-31-19-22(20)17-21/h5-7,9,13,16-17,19,24-25,27-28H,8,10-12,14-15,18H2,1-4H3/t24-,25-,27-,28-,29-,30+/m0/s1 |
| InChIKey | QKNQHSHNIBPTGI-GIHFEDOESA-N |
| XLogP | 7.12 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|