C19H34O3 — CID 155326761
(2S,3R,5R,6R)-2,3,5-trimethyl-6-[(2R,5E)-7-propan-2-yloxyocta-5,7-dien-2-yl]oxyoxane (PubChem CID 155326761) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (2S,3R,5R,6R)-2,3,5-trimethyl-6-[(2R,5E)-7-propan-2-yloxyocta-5,7-dien-2-yl]oxyoxane.
| Compound Name | (2S,3R,5R,6R)-2,3,5-trimethyl-6-[(2R,5E)-7-propan-2-yloxyocta-5,7-dien-2-yl]oxyoxane |
|---|---|
| PubChem CID | 155326761 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (2S,3R,5R,6R)-2,3,5-trimethyl-6-[(2R,5E)-7-propan-2-yloxyocta-5,7-dien-2-yl]oxyoxane |
| SMILES | C=C(/C=C/CC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](C)C[C@H]1C)OC(C)C |
| InChI | InChI=1S/C19H34O3/c1-13(2)20-16(5)10-8-9-11-17(6)21-19-15(4)12-14(3)18(7)22-19/h8,10,13-15,17-19H,5,9,11-12H2,1-4,6-7H3/b10-8+/t14-,15-,17-,18+,19-/m1/s1 |
| InChIKey | CGJHCBQCJPJHGB-PQXCDXMHSA-N |
| XLogP | 5.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|