C21H38O4 — CID 155326855
(2S,3R,5R,6R)-6-[(2R,5E)-7-(2-ethylbutoxy)octa-5,7-dien-2-yl]oxy-2,5-dimethyloxan-3-ol (PubChem CID 155326855) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (2S,3R,5R,6R)-6-[(2R,5E)-7-(2-ethylbutoxy)octa-5,7-dien-2-yl]oxy-2,5-dimethyloxan-3-ol.
| Compound Name | (2S,3R,5R,6R)-6-[(2R,5E)-7-(2-ethylbutoxy)octa-5,7-dien-2-yl]oxy-2,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 155326855 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (2S,3R,5R,6R)-6-[(2R,5E)-7-(2-ethylbutoxy)octa-5,7-dien-2-yl]oxy-2,5-dimethyloxan-3-ol |
| SMILES | C=C(/C=C/CC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1C)OCC(CC)CC |
| InChI | InChI=1S/C21H38O4/c1-7-19(8-2)14-23-16(4)11-9-10-12-17(5)24-21-15(3)13-20(22)18(6)25-21/h9,11,15,17-22H,4,7-8,10,12-14H2,1-3,5-6H3/b11-9+/t15-,17-,18+,20-,21-/m1/s1 |
| InChIKey | BWVJLHWWFFKBKQ-PJNGKQFOSA-N |
| XLogP | 4.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|