C22H38O3 — CID 155326945
(2S,3R,5R,6S)-2,3,5-trimethyl-6-[1-[(3E)-5-[(2-methylpropan-2-yl)oxy]hexa-3,5-dienyl]cyclobutyl]oxyoxane (PubChem CID 155326945) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (2S,3R,5R,6S)-2,3,5-trimethyl-6-[1-[(3E)-5-[(2-methylpropan-2-yl)oxy]hexa-3,5-dienyl]cyclobutyl]oxyoxane.
| Compound Name | (2S,3R,5R,6S)-2,3,5-trimethyl-6-[1-[(3E)-5-[(2-methylpropan-2-yl)oxy]hexa-3,5-dienyl]cyclobutyl]oxyoxane |
|---|---|
| PubChem CID | 155326945 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (2S,3R,5R,6S)-2,3,5-trimethyl-6-[1-[(3E)-5-[(2-methylpropan-2-yl)oxy]hexa-3,5-dienyl]cyclobutyl]oxyoxane |
| SMILES | C=C(/C=C/CCC1(O[C@@H]2O[C@@H](C)[C@H](C)C[C@H]2C)CCC1)OC(C)(C)C |
| InChI | InChI=1S/C22H38O3/c1-16-15-17(2)20(23-19(16)4)25-22(13-10-14-22)12-9-8-11-18(3)24-21(5,6)7/h8,11,16-17,19-20H,3,9-10,12-15H2,1-2,4-7H3/b11-8+/t16-,17-,19+,20+/m1/s1 |
| InChIKey | HLNHMSKRUGRQQM-MZVDPSAJSA-N |
| XLogP | 6.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|