C13H17NO2 — CID 155327053
2-[3-[2-(ethylideneamino)ethyl]cyclohepta-1,3,6-trien-1-yl]acetic acid (PubChem CID 155327053) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[3-[2-(ethylideneamino)ethyl]cyclohepta-1,3,6-trien-1-yl]acetic acid.
| Compound Name | 2-[3-[2-(ethylideneamino)ethyl]cyclohepta-1,3,6-trien-1-yl]acetic acid |
|---|---|
| PubChem CID | 155327053 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-[3-[2-(ethylideneamino)ethyl]cyclohepta-1,3,6-trien-1-yl]acetic acid |
| SMILES | C/C=N/CCC1=CCC=CC(CC(=O)O)=C1 |
| InChI | InChI=1S/C13H17NO2/c1-2-14-8-7-11-5-3-4-6-12(9-11)10-13(15)16/h2,4-6,9H,3,7-8,10H2,1H3,(H,15,16)/b14-2+ |
| InChIKey | UDBBKQNWKWQZMX-JLZUIIAYSA-N |
| XLogP | 2.75 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|