C19H34O3 — CID 155327061
(2S,3R,5R,6R)-2,3,5-trimethyl-6-[(4E)-6-[(2-methylpropan-2-yl)oxy]hepta-4,6-dienoxy]oxane (PubChem CID 155327061) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (2S,3R,5R,6R)-2,3,5-trimethyl-6-[(4E)-6-[(2-methylpropan-2-yl)oxy]hepta-4,6-dienoxy]oxane.
| Compound Name | (2S,3R,5R,6R)-2,3,5-trimethyl-6-[(4E)-6-[(2-methylpropan-2-yl)oxy]hepta-4,6-dienoxy]oxane |
|---|---|
| PubChem CID | 155327061 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (2S,3R,5R,6R)-2,3,5-trimethyl-6-[(4E)-6-[(2-methylpropan-2-yl)oxy]hepta-4,6-dienoxy]oxane |
| SMILES | C=C(/C=C/CCCO[C@@H]1O[C@@H](C)[C@H](C)C[C@H]1C)OC(C)(C)C |
| InChI | InChI=1S/C19H34O3/c1-14-13-15(2)18(21-17(14)4)20-12-10-8-9-11-16(3)22-19(5,6)7/h9,11,14-15,17-18H,3,8,10,12-13H2,1-2,4-7H3/b11-9+/t14-,15-,17+,18-/m1/s1 |
| InChIKey | PKLUIPBDGQGEPE-QEVRUHENSA-N |
| XLogP | 5.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|