C11H11F2N3O2 — CID 155327134
(3aR,6aS)-5-(4-amino-2,6-difluorophenyl)-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-2-one (PubChem CID 155327134) has the molecular formula C11H11F2N3O2 and a molecular weight of 255.22 g/mol. Its IUPAC name is (3aR,6aS)-5-(4-amino-2,6-difluorophenyl)-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,6aS)-5-(4-amino-2,6-difluorophenyl)-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 155327134 |
| Molecular Formula | C11H11F2N3O2 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (3aR,6aS)-5-(4-amino-2,6-difluorophenyl)-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-2-one |
| SMILES | Nc1cc(F)c(N2C[C@@H]3OC(=O)N[C@@H]3C2)c(F)c1 |
| InChI | InChI=1S/C11H11F2N3O2/c12-6-1-5(14)2-7(13)10(6)16-3-8-9(4-16)18-11(17)15-8/h1-2,8-9H,3-4,14H2,(H,15,17)/t8-,9+/m1/s1 |
| InChIKey | YBLNVNSQBLRJBC-BDAKNGLRSA-N |
| XLogP | 0.84 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|