C17H23NO3 — CID 155327377
(6aR,10aS)-7-propyl-6a,8,9,10,10a,11-hexahydro-6H-[1,3]benzodioxolo[7,6-g]quinolin-11-ol (PubChem CID 155327377) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (6aR,10aS)-7-propyl-6a,8,9,10,10a,11-hexahydro-6H-[1,3]benzodioxolo[7,6-g]quinolin-11-ol.
| Compound Name | (6aR,10aS)-7-propyl-6a,8,9,10,10a,11-hexahydro-6H-[1,3]benzodioxolo[7,6-g]quinolin-11-ol |
|---|---|
| PubChem CID | 155327377 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (6aR,10aS)-7-propyl-6a,8,9,10,10a,11-hexahydro-6H-[1,3]benzodioxolo[7,6-g]quinolin-11-ol |
| SMILES | CCCN1CCC[C@@H]2C(O)c3c(ccc4c3OCO4)C[C@H]21 |
| InChI | InChI=1S/C17H23NO3/c1-2-7-18-8-3-4-12-13(18)9-11-5-6-14-17(21-10-20-14)15(11)16(12)19/h5-6,12-13,16,19H,2-4,7-10H2,1H3/t12-,13+,16?/m0/s1 |
| InChIKey | KZEHISRKQQIXMT-FTLRAWMYSA-N |
| XLogP | 2.50 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |