C26H27F2N3O4S — CID 155327407
2-[[(5R)-3-[4-(1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-2-hydroxy-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione (PubChem CID 155327407) has the molecular formula C26H27F2N3O4S and a molecular weight of 515.58 g/mol. Its IUPAC name is 2-[[(5R)-3-[4-(1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-2-hydroxy-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(5R)-3-[4-(1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-2-hydroxy-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155327407 |
| Molecular Formula | C26H27F2N3O4S |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 2-[[(5R)-3-[4-(1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-2-hydroxy-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H]1CN(c2cc(F)c(N3CC4CCSCCC4C3)c(F)c2)C(O)O1 |
| InChI | InChI=1S/C26H27F2N3O4S/c27-21-9-17(10-22(28)23(21)29-11-15-5-7-36-8-6-16(15)12-29)30-13-18(35-26(30)34)14-31-24(32)19-3-1-2-4-20(19)25(31)33/h1-4,9-10,15-16,18,26,34H,5-8,11-14H2/t15?,16?,18-,26?/m1/s1 |
| InChIKey | PZGSDKQGUPEWBL-FZSQSFLKSA-N |
| XLogP | 3.32 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|