C20H29N3O7S — CID 155327482
(4S)-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxo-5-sulfanylpentanoic acid (PubChem CID 155327482) has the molecular formula C20H29N3O7S and a molecular weight of 455.53 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxo-5-sulfanylpentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxo-5-sulfanylpentanoic acid |
|---|---|
| PubChem CID | 155327482 |
| Molecular Formula | C20H29N3O7S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (4S)-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxo-5-sulfanylpentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCC(=O)O)C(=O)S |
| InChI | InChI=1S/C20H29N3O7S/c1-12(2)18(19(29)21-13(20(30)31)7-10-17(27)28)22-14(24)6-4-3-5-11-23-15(25)8-9-16(23)26/h8-9,12-13,18H,3-7,10-11H2,1-2H3,(H,21,29)(H,22,24)(H,27,28)(H,30,31)/t13-,18-/m0/s1 |
| InChIKey | YDCODWDMQTYRBH-UGSOOPFHSA-N |
| XLogP | 0.42 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|