C30H44N2 — CID 155328019
N-[(1Z)-1-[7-(2,3-dimethylhex-4-en-3-yl)-1,2,2-trimethyl-11-propan-2-ylidene-3,6,7,8-tetrahydrobenzo[b]quinolizin-4-ylidene]ethyl]methanimine (PubChem CID 155328019) has the molecular formula C30H44N2 and a molecular weight of 432.70 g/mol. Its IUPAC name is N-[(1Z)-1-[7-(2,3-dimethylhex-4-en-3-yl)-1,2,2-trimethyl-11-propan-2-ylidene-3,6,7,8-tetrahydrobenzo[b]quinolizin-4-ylidene]ethyl]methanimine.
| Compound Name | N-[(1Z)-1-[7-(2,3-dimethylhex-4-en-3-yl)-1,2,2-trimethyl-11-propan-2-ylidene-3,6,7,8-tetrahydrobenzo[b]quinolizin-4-ylidene]ethyl]methanimine |
|---|---|
| PubChem CID | 155328019 |
| Molecular Formula | C30H44N2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | N-[(1Z)-1-[7-(2,3-dimethylhex-4-en-3-yl)-1,2,2-trimethyl-11-propan-2-ylidene-3,6,7,8-tetrahydrobenzo[b]quinolizin-4-ylidene]ethyl]methanimine |
| SMILES | C=N/C(C)=C1/CC(C)(C)C(C)=C2C(=C(C)C)C3=C(CN21)C(C(C)(C=CC)C(C)C)CC=C3 |
| InChI | InChI=1S/C30H44N2/c1-12-16-30(10,20(4)5)25-15-13-14-23-24(25)18-32-26(22(7)31-11)17-29(8,9)21(6)28(32)27(23)19(2)3/h12-14,16,20,25H,11,15,17-18H2,1-10H3/b16-12?,26-22- |
| InChIKey | SCULMRSYRIHGAI-FMQBWFGMSA-N |
| XLogP | 8.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|