C17H16N4O2 — CID 155328078
5-[5-ethyl-2-(methylideneamino)-3-[(Z)-prop-1-enyl]imidazole-4-carbonyl]-2-hydroxybenzonitrile (PubChem CID 155328078) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 5-[5-ethyl-2-(methylideneamino)-3-[(Z)-prop-1-enyl]imidazole-4-carbonyl]-2-hydroxybenzonitrile.
| Compound Name | 5-[5-ethyl-2-(methylideneamino)-3-[(Z)-prop-1-enyl]imidazole-4-carbonyl]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 155328078 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-[5-ethyl-2-(methylideneamino)-3-[(Z)-prop-1-enyl]imidazole-4-carbonyl]-2-hydroxybenzonitrile |
| SMILES | C=Nc1nc(CC)c(C(=O)c2ccc(O)c(C#N)c2)n1/C=C\C |
| InChI | InChI=1S/C17H16N4O2/c1-4-8-21-15(13(5-2)20-17(21)19-3)16(23)11-6-7-14(22)12(9-11)10-18/h4,6-9,22H,3,5H2,1-2H3/b8-4- |
| InChIKey | DIVIBFOLRNISQD-YWEYNIOJSA-N |
| XLogP | 3.08 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|