C26H38O4 — CID 155328085
[(3S,8R,9S,10R,12R,13S,14S,17Z)-12-acetyloxy-17-ethylidene-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 155328085) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is [(3S,8R,9S,10R,12R,13S,14S,17Z)-12-acetyloxy-17-ethylidene-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,12R,13S,14S,17Z)-12-acetyloxy-17-ethylidene-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 155328085 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | [(3S,8R,9S,10R,12R,13S,14S,17Z)-12-acetyloxy-17-ethylidene-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | C/C=C1/C(C)C[C@H]2[C@@H]3CC=C4C[C@@H](OC(C)=O)CC[C@]4(C)[C@H]3C[C@@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C26H38O4/c1-7-21-15(2)12-23-20-9-8-18-13-19(29-16(3)27)10-11-25(18,5)22(20)14-24(26(21,23)6)30-17(4)28/h7-8,15,19-20,22-24H,9-14H2,1-6H3/b21-7-/t15?,19-,20+,22-,23-,24+,25-,26+/m0/s1 |
| InChIKey | XLABZQLYJQNBNK-HCQLNCKESA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|