C13H8F7N3O2 — CID 155328219
5-fluoro-3-[(5-fluoro-2-methoxy-3-pyridinyl)methyl]-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one (PubChem CID 155328219) has the molecular formula C13H8F7N3O2 and a molecular weight of 371.21 g/mol. Its IUPAC name is 5-fluoro-3-[(5-fluoro-2-methoxy-3-pyridinyl)methyl]-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one.
| Compound Name | 5-fluoro-3-[(5-fluoro-2-methoxy-3-pyridinyl)methyl]-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 155328219 |
| Molecular Formula | C13H8F7N3O2 |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 5-fluoro-3-[(5-fluoro-2-methoxy-3-pyridinyl)methyl]-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one |
| SMILES | COc1ncc(F)cc1Cn1cnc(C(F)(F)C(F)(F)F)c(F)c1=O |
| InChI | InChI=1S/C13H8F7N3O2/c1-25-10-6(2-7(14)3-21-10)4-23-5-22-9(8(15)11(23)24)12(16,17)13(18,19)20/h2-3,5H,4H2,1H3 |
| InChIKey | TWYLSSTXONOJCY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|