C17H15N5OS — CID 155328492
1-N-[5-(1H-indazol-5-yl)-1,3-oxazol-2-yl]-3-N-methylsulfanylbenzene-1,3-diamine (PubChem CID 155328492) has the molecular formula C17H15N5OS and a molecular weight of 337.41 g/mol. Its IUPAC name is 1-N-[5-(1H-indazol-5-yl)-1,3-oxazol-2-yl]-3-N-methylsulfanylbenzene-1,3-diamine.
| Compound Name | 1-N-[5-(1H-indazol-5-yl)-1,3-oxazol-2-yl]-3-N-methylsulfanylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 155328492 |
| Molecular Formula | C17H15N5OS |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-N-[5-(1H-indazol-5-yl)-1,3-oxazol-2-yl]-3-N-methylsulfanylbenzene-1,3-diamine |
| SMILES | CSNc1cccc(Nc2ncc(-c3ccc4[nH]ncc4c3)o2)c1 |
| InChI | InChI=1S/C17H15N5OS/c1-24-22-14-4-2-3-13(8-14)20-17-18-10-16(23-17)11-5-6-15-12(7-11)9-19-21-15/h2-10,22H,1H3,(H,18,20)(H,19,21) |
| InChIKey | YUNSDHTUJACNEJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|