C10H20N2O2 — CID 155328530
(1,2,2,6,6-pentamethylpiperidin-4-yl) nitrite (PubChem CID 155328530) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) nitrite.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) nitrite |
|---|---|
| PubChem CID | 155328530 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) nitrite |
| SMILES | CN1C(C)(C)CC(ON=O)CC1(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-9(2)6-8(14-11-13)7-10(3,4)12(9)5/h8H,6-7H2,1-5H3 |
| InChIKey | NBPKXUKMRAZJQM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|