C41H25N5S — CID 155328603
2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-3-yl]-4-phenylquinazoline (PubChem CID 155328603) has the molecular formula C41H25N5S and a molecular weight of 619.75 g/mol. Its IUPAC name is 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-3-yl]-4-phenylquinazoline.
| Compound Name | 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-3-yl]-4-phenylquinazoline |
|---|---|
| PubChem CID | 155328603 |
| Molecular Formula | C41H25N5S |
| Molecular Weight | 619.75 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-3-yl]-4-phenylquinazoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4sc5cc(-c6nc(-c7ccccc7)c7ccccc7n6)ccc5c4c3)n2)cc1 |
| InChI | InChI=1S/C41H25N5S/c1-4-12-26(13-5-1)37-32-18-10-11-19-34(32)42-40(43-37)30-20-22-31-33-24-29(21-23-35(33)47-36(31)25-30)41-45-38(27-14-6-2-7-15-27)44-39(46-41)28-16-8-3-9-17-28/h1-25H |
| InChIKey | LEEQJRKHUPECOW-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.75 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |